C41H46N2O10 — CID 76787872
4-[2-methoxy-4-[3-[4-[3-[3-methoxy-4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl-methylamino]anilino]-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate (PubChem CID 76787872) has the molecular formula C41H46N2O10 and a molecular weight of 726.82 g/mol. Its IUPAC name is 4-[2-methoxy-4-[3-[4-[3-[3-methoxy-4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl-methylamino]anilino]-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate.
| Compound Name | 4-[2-methoxy-4-[3-[4-[3-[3-methoxy-4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl-methylamino]anilino]-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate |
|---|---|
| PubChem CID | 76787872 |
| Molecular Formula | C41H46N2O10 |
| Molecular Weight | 726.82 g/mol |
| Exact Mass | 726.32 |
| IUPAC Name | 4-[2-methoxy-4-[3-[4-[3-[3-methoxy-4-(4-prop-2-enoyloxybutoxy)phenyl]prop-2-enoyl-methylamino]anilino]-3-oxoprop-1-enyl]phenoxy]butyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCOc1ccc(C=CC(=O)Nc2ccc(N(C)C(=O)C=Cc3ccc(OCCCCOC(=O)C=C)c(OC)c3)cc2)cc1OC |
| InChI | InChI=1S/C41H46N2O10/c1-6-40(46)52-26-10-8-24-50-34-20-12-30(28-36(34)48-4)14-22-38(44)42-32-16-18-33(19-17-32)43(3)39(45)23-15-31-13-21-35(37(29-31)49-5)51-25-9-11-27-53-41(47)7-2/h6-7,12-23,28-29H,1-2,8-11,24-27H2,3-5H3,(H,42,44) |
| InChIKey | VWWFHQXUIZUCSR-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 138.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.82 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|