C25H33NO4 — CID 2791081
3-(4-hexoxy-3-methoxyphenyl)-N-(4-propan-2-yloxyphenyl)prop-2-enamide (PubChem CID 2791081) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is 3-(4-hexoxy-3-methoxyphenyl)-N-(4-propan-2-yloxyphenyl)prop-2-enamide.
| Compound Name | 3-(4-hexoxy-3-methoxyphenyl)-N-(4-propan-2-yloxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 2791081 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 3-(4-hexoxy-3-methoxyphenyl)-N-(4-propan-2-yloxyphenyl)prop-2-enamide |
| SMILES | CCCCCCOc1ccc(C=CC(=O)Nc2ccc(OC(C)C)cc2)cc1OC |
| InChI | InChI=1S/C25H33NO4/c1-5-6-7-8-17-29-23-15-9-20(18-24(23)28-4)10-16-25(27)26-21-11-13-22(14-12-21)30-19(2)3/h9-16,18-19H,5-8,17H2,1-4H3,(H,26,27) |
| InChIKey | KTVLYYRNLYPKCP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|