C13H27NO2S2 — CID 59502334
2-[2-(tert-butylamino)ethyldisulfanyl]ethyl 2,2-dimethylpropanoate (PubChem CID 59502334) has the molecular formula C13H27NO2S2 and a molecular weight of 293.50 g/mol. Its IUPAC name is 2-[2-(tert-butylamino)ethyldisulfanyl]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[2-(tert-butylamino)ethyldisulfanyl]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59502334 |
| Molecular Formula | C13H27NO2S2 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.15 |
| IUPAC Name | 2-[2-(tert-butylamino)ethyldisulfanyl]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)NCCSSCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H27NO2S2/c1-12(2,3)11(15)16-8-10-18-17-9-7-14-13(4,5)6/h14H,7-10H2,1-6H3 |
| InChIKey | SFEDPZRYOZNGEN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|