C20H36N2O8S — CID 176588653
2-[2-[2-[2-(2,2-dimethylpropanoyloxy)ethylcarbamoyloxy]ethylsulfanyl]ethoxycarbonylamino]ethyl 2,2-dimethylpropanoate (PubChem CID 176588653) has the molecular formula C20H36N2O8S and a molecular weight of 464.58 g/mol. Its IUPAC name is 2-[2-[2-[2-(2,2-dimethylpropanoyloxy)ethylcarbamoyloxy]ethylsulfanyl]ethoxycarbonylamino]ethyl 2,2-dimethylpropanoate.
| Compound Name | 2-[2-[2-[2-(2,2-dimethylpropanoyloxy)ethylcarbamoyloxy]ethylsulfanyl]ethoxycarbonylamino]ethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 176588653 |
| Molecular Formula | C20H36N2O8S |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 2-[2-[2-[2-(2,2-dimethylpropanoyloxy)ethylcarbamoyloxy]ethylsulfanyl]ethoxycarbonylamino]ethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCNC(=O)OCCSCCOC(=O)NCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C20H36N2O8S/c1-19(2,3)15(23)27-9-7-21-17(25)29-11-13-31-14-12-30-18(26)22-8-10-28-16(24)20(4,5)6/h7-14H2,1-6H3,(H,21,25)(H,22,26) |
| InChIKey | PKVHWQLAJLGIGF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|