C7H15O5PS — CID 159079365
2-(2,2-dimethylpropanoyloxy)ethylsulfanylphosphonic acid (PubChem CID 159079365) has the molecular formula C7H15O5PS and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoyloxy)ethylsulfanylphosphonic acid.
| Compound Name | 2-(2,2-dimethylpropanoyloxy)ethylsulfanylphosphonic acid |
|---|---|
| PubChem CID | 159079365 |
| Molecular Formula | C7H15O5PS |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 2-(2,2-dimethylpropanoyloxy)ethylsulfanylphosphonic acid |
| SMILES | CC(C)(C)C(=O)OCCSP(=O)(O)O |
| InChI | InChI=1S/C7H15O5PS/c1-7(2,3)6(8)12-4-5-14-13(9,10)11/h4-5H2,1-3H3,(H2,9,10,11) |
| InChIKey | NWXOZVBKTFBUPB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|