C8H17O4P — CID 59034886
dimethylphosphoryloxymethyl 2,2-dimethylpropanoate (PubChem CID 59034886) has the molecular formula C8H17O4P and a molecular weight of 208.19 g/mol. Its IUPAC name is dimethylphosphoryloxymethyl 2,2-dimethylpropanoate.
| Compound Name | dimethylphosphoryloxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 59034886 |
| Molecular Formula | C8H17O4P |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | dimethylphosphoryloxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOP(C)(C)=O |
| InChI | InChI=1S/C8H17O4P/c1-8(2,3)7(9)11-6-12-13(4,5)10/h6H2,1-5H3 |
| InChIKey | IQLMNZDNUAQCKA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|