C16H29O7P — CID 156661192
[but-3-enyl(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 156661192) has the molecular formula C16H29O7P and a molecular weight of 364.38 g/mol. Its IUPAC name is [but-3-enyl(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [but-3-enyl(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 156661192 |
| Molecular Formula | C16H29O7P |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | [but-3-enyl(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | C=CCCP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H29O7P/c1-8-9-10-24(19,22-11-20-13(17)15(2,3)4)23-12-21-14(18)16(5,6)7/h8H,1,9-12H2,2-7H3 |
| InChIKey | NJNHHFJCEFDGEU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|