C20H37O8P — CID 155546594
[2,2-dimethylpropanoyloxymethoxy-[(E)-7-hydroxy-6-methylhept-5-enyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 155546594) has the molecular formula C20H37O8P and a molecular weight of 436.48 g/mol. Its IUPAC name is [2,2-dimethylpropanoyloxymethoxy-[(E)-7-hydroxy-6-methylhept-5-enyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2,2-dimethylpropanoyloxymethoxy-[(E)-7-hydroxy-6-methylhept-5-enyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 155546594 |
| Molecular Formula | C20H37O8P |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [2,2-dimethylpropanoyloxymethoxy-[(E)-7-hydroxy-6-methylhept-5-enyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | C/C(=C\CCCCP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)CO |
| InChI | InChI=1S/C20H37O8P/c1-16(13-21)11-9-8-10-12-29(24,27-14-25-17(22)19(2,3)4)28-15-26-18(23)20(5,6)7/h11,21H,8-10,12-15H2,1-7H3/b16-11+ |
| InChIKey | YKOFLJHBCQQVQI-LFIBNONCSA-N |
| XLogP | 4.42 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|