C8H15Na2O4P — CID 155542514
disodium;(E)-2-methyl-7-phosphonatohept-2-en-1-ol (PubChem CID 155542514) has the molecular formula C8H15Na2O4P and a molecular weight of 252.16 g/mol. Its IUPAC name is disodium;(E)-2-methyl-7-phosphonatohept-2-en-1-ol.
| Compound Name | disodium;(E)-2-methyl-7-phosphonatohept-2-en-1-ol |
|---|---|
| PubChem CID | 155542514 |
| Molecular Formula | C8H15Na2O4P |
| Molecular Weight | 252.16 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | disodium;(E)-2-methyl-7-phosphonatohept-2-en-1-ol |
| SMILES | C/C(=C\CCCCP(=O)([O-])[O-])CO.[Na+].[Na+] |
| InChI | InChI=1S/C8H17O4P.2Na/c1-8(7-9)5-3-2-4-6-13(10,11)12;;/h5,9H,2-4,6-7H2,1H3,(H2,10,11,12);;/q;2*+1/p-2/b8-5+;; |
| InChIKey | YPQAMEGGXSMQCL-RMZRELHQSA-L |
| XLogP | -5.98 |
| TPSA | 83.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.16 |
| LogP ≤ 5 | -5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|