C14H27N2O6P — CID 172578385
methyl (2S)-2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate (PubChem CID 172578385) has the molecular formula C14H27N2O6P and a molecular weight of 350.35 g/mol. Its IUPAC name is methyl (2S)-2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 172578385 |
| Molecular Formula | C14H27N2O6P |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | methyl (2S)-2-[[[(E)-5-hydroxy-4-methylpent-3-enyl]-[[(2S)-1-methoxy-1-oxopropan-2-yl]amino]phosphoryl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NP(=O)(CC/C=C(\C)CO)N[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C14H27N2O6P/c1-10(9-17)7-6-8-23(20,15-11(2)13(18)21-4)16-12(3)14(19)22-5/h7,11-12,17H,6,8-9H2,1-5H3,(H2,15,16,20)/b10-7+/t11-,12-/m0/s1 |
| InChIKey | AEJJQVRIKFUQBP-SKWDFFSCSA-N |
| XLogP | 0.81 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|