C12H16O4P- — CID 172675748
[(E)-5-hydroxy-4-methylpent-3-enyl]-phenoxyphosphinate (PubChem CID 172675748) has the molecular formula C12H16O4P- and a molecular weight of 255.23 g/mol. Its IUPAC name is [(E)-5-hydroxy-4-methylpent-3-enyl]-phenoxyphosphinate.
| Compound Name | [(E)-5-hydroxy-4-methylpent-3-enyl]-phenoxyphosphinate |
|---|---|
| PubChem CID | 172675748 |
| Molecular Formula | C12H16O4P- |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | [(E)-5-hydroxy-4-methylpent-3-enyl]-phenoxyphosphinate |
| SMILES | C/C(=C\CCP(=O)([O-])Oc1ccccc1)CO |
| InChI | InChI=1S/C12H17O4P/c1-11(10-13)6-5-9-17(14,15)16-12-7-3-2-4-8-12/h2-4,6-8,13H,5,9-10H2,1H3,(H,14,15)/p-1/b11-6+ |
| InChIKey | DDDRAYWJOMEWHJ-IZZDOVSWSA-M |
| XLogP | 1.95 |
| TPSA | 69.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|