About 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one
2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one (PubChem CID 157296988) has the molecular formula C15H28NO6P
and a molecular weight of 349.36 g/mol. Its IUPAC name is 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one.
Molecular Properties
| Compound Name | 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one |
| PubChem CID | 157296988 |
| Molecular Formula | C15H28NO6P |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one |
| SMILES | CC.CC(=O)CO.C[NH+](C)CCOP(=O)([O-])Oc1ccccc1 |
| InChI | InChI=1S/C10H16NO4P.C3H6O2.C2H6/c1-11(2)8-9-14-16(12,13)15-10-6-4-3-5-7-10;1-3(5)2-4;1-2/h3-7H,8-9H2,1-2H3,(H,12,13);4H,2H2,1H3;1-2H3 |
| InChIKey | BBLOZEOXXYZOMP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 100.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one?
The IUPAC name of 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one (CID 157296988) is 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one.
What is the SMILES notation for 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one?
The canonical SMILES for 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one is CC.CC(=O)CO.C[NH+](C)CCOP(=O)([O-])Oc1ccccc1.
What is the InChIKey of 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one?
The InChIKey is BBLOZEOXXYZOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16NO4P.C3H6O2.C2H6/c1-11(2)8-9-14-16(12,13)15-10-6-4-3-5-7-10;1-3(5)2-4;1-2/h3-7H,8-9H2,1-2H3,(H,12,13);4H,2H2,1H3;1-2H3.
What are the key properties of 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one?
2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one has a molecular weight of 349.36 g/mol, XLogP of 0.29, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylazaniumyl)ethyl phenyl phosphate;ethane;1-hydroxypropan-2-one is sourced from PubChem (CID 157296988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).