C18H29N2O2P — CID 162432067
4-methyl-N-[(4-methylpent-3-enylamino)-phenoxyphosphoryl]pent-3-en-1-amine (PubChem CID 162432067) has the molecular formula C18H29N2O2P and a molecular weight of 336.42 g/mol. Its IUPAC name is 4-methyl-N-[(4-methylpent-3-enylamino)-phenoxyphosphoryl]pent-3-en-1-amine.
| Compound Name | 4-methyl-N-[(4-methylpent-3-enylamino)-phenoxyphosphoryl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 162432067 |
| Molecular Formula | C18H29N2O2P |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 4-methyl-N-[(4-methylpent-3-enylamino)-phenoxyphosphoryl]pent-3-en-1-amine |
| SMILES | CC(C)=CCCNP(=O)(NCCC=C(C)C)Oc1ccccc1 |
| InChI | InChI=1S/C18H29N2O2P/c1-16(2)10-8-14-19-23(21,20-15-9-11-17(3)4)22-18-12-6-5-7-13-18/h5-7,10-13H,8-9,14-15H2,1-4H3,(H2,19,20,21) |
| InChIKey | UADXCXDWWIWAJG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|