C19H31N2O2P — CID 166922433
N,4-dimethyl-N-[[methyl(3-methylbut-2-enyl)amino]-phenoxyphosphoryl]pent-3-en-1-amine (PubChem CID 166922433) has the molecular formula C19H31N2O2P and a molecular weight of 350.44 g/mol. Its IUPAC name is N,4-dimethyl-N-[[methyl(3-methylbut-2-enyl)amino]-phenoxyphosphoryl]pent-3-en-1-amine.
| Compound Name | N,4-dimethyl-N-[[methyl(3-methylbut-2-enyl)amino]-phenoxyphosphoryl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 166922433 |
| Molecular Formula | C19H31N2O2P |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | N,4-dimethyl-N-[[methyl(3-methylbut-2-enyl)amino]-phenoxyphosphoryl]pent-3-en-1-amine |
| SMILES | CC(C)=CCCN(C)P(=O)(Oc1ccccc1)N(C)CC=C(C)C |
| InChI | InChI=1S/C19H31N2O2P/c1-17(2)11-10-15-20(5)24(22,21(6)16-14-18(3)4)23-19-12-8-7-9-13-19/h7-9,11-14H,10,15-16H2,1-6H3 |
| InChIKey | DKQIPODLVWUPOH-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|