About 2-(dimethylamino)ethyl diphenyl phosphate
2-(dimethylamino)ethyl diphenyl phosphate (PubChem CID 169439172) has the molecular formula C16H20NO4P
and a molecular weight of 321.31 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl diphenyl phosphate.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl diphenyl phosphate |
| PubChem CID | 169439172 |
| Molecular Formula | C16H20NO4P |
| Molecular Weight | 321.31 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 2-(dimethylamino)ethyl diphenyl phosphate |
| SMILES | CN(C)CCOP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C16H20NO4P/c1-17(2)13-14-19-22(18,20-15-9-5-3-6-10-15)21-16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3 |
| InChIKey | CWNXYBRNDJVMHH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl diphenyl phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl diphenyl phosphate?
The IUPAC name of 2-(dimethylamino)ethyl diphenyl phosphate (CID 169439172) is 2-(dimethylamino)ethyl diphenyl phosphate.
What is the SMILES notation for 2-(dimethylamino)ethyl diphenyl phosphate?
The canonical SMILES for 2-(dimethylamino)ethyl diphenyl phosphate is CN(C)CCOP(=O)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of 2-(dimethylamino)ethyl diphenyl phosphate?
The InChIKey is CWNXYBRNDJVMHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20NO4P/c1-17(2)13-14-19-22(18,20-15-9-5-3-6-10-15)21-16-11-7-4-8-12-16/h3-12H,13-14H2,1-2H3.
What are the key properties of 2-(dimethylamino)ethyl diphenyl phosphate?
2-(dimethylamino)ethyl diphenyl phosphate has a molecular weight of 321.31 g/mol, XLogP of 3.83, 8 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl diphenyl phosphate is sourced from PubChem (CID 169439172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).