About Phenyl tetrapropyl triphosphate
Phenyl tetrapropyl triphosphate (PubChem CID 3058504) has the molecular formula C18H33O10P3
and a molecular weight of 502.40 g/mol. Its IUPAC name is dipropoxyphosphoryl [phenoxy(propoxy)phosphoryl] propyl phosphate.
Molecular Properties
| Compound Name | Phenyl tetrapropyl triphosphate |
| PubChem CID | 3058504 |
| Molecular Formula | C18H33O10P3 |
| Molecular Weight | 502.40 g/mol |
| Exact Mass | 502.13 |
| IUPAC Name | dipropoxyphosphoryl [phenoxy(propoxy)phosphoryl] propyl phosphate |
| SMILES | CCCOP(=O)(OCCC)OP(=O)(OCCC)OP(=O)(OCCC)OC1=CC=CC=C1 |
| InChI | InChI=1S/C18H33O10P3/c1-5-14-22-29(19,23-15-6-2)27-31(21,25-17-8-4)28-30(20,24-16-7-3)26-18-12-10-9-11-13-18/h9-13H,5-8,14-17H2,1-4H3 |
| InChIKey | WVZITCXGFJEBEW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 116.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | 612 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 502.40 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze Phenyl tetrapropyl triphosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Phenyl tetrapropyl triphosphate?
The IUPAC name of Phenyl tetrapropyl triphosphate (CID 3058504) is dipropoxyphosphoryl [phenoxy(propoxy)phosphoryl] propyl phosphate.
What is the SMILES notation for Phenyl tetrapropyl triphosphate?
The canonical SMILES for Phenyl tetrapropyl triphosphate is CCCOP(=O)(OCCC)OP(=O)(OCCC)OP(=O)(OCCC)OC1=CC=CC=C1.
What is the InChIKey of Phenyl tetrapropyl triphosphate?
The InChIKey is WVZITCXGFJEBEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33O10P3/c1-5-14-22-29(19,23-15-6-2)27-31(21,25-17-8-4)28-30(20,24-16-7-3)26-18-12-10-9-11-13-18/h9-13H,5-8,14-17H2,1-4H3.
What are the key properties of Phenyl tetrapropyl triphosphate?
Phenyl tetrapropyl triphosphate has a molecular weight of 502.40 g/mol, XLogP of 4.20, 18 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for Phenyl tetrapropyl triphosphate is sourced from PubChem (CID 3058504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).