C17H30ClN2O2P — CID 19733994
N-[(4-chlorophenoxy)-[methyl(2-methylpropyl)amino]phosphoryl]-N,3-dimethylbutan-1-amine (PubChem CID 19733994) has the molecular formula C17H30ClN2O2P and a molecular weight of 360.87 g/mol. Its IUPAC name is N-[(4-chlorophenoxy)-[methyl(2-methylpropyl)amino]phosphoryl]-N,3-dimethylbutan-1-amine.
| Compound Name | N-[(4-chlorophenoxy)-[methyl(2-methylpropyl)amino]phosphoryl]-N,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 19733994 |
| Molecular Formula | C17H30ClN2O2P |
| Molecular Weight | 360.87 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | N-[(4-chlorophenoxy)-[methyl(2-methylpropyl)amino]phosphoryl]-N,3-dimethylbutan-1-amine |
| SMILES | CC(C)CCN(C)P(=O)(Oc1ccc(Cl)cc1)N(C)CC(C)C |
| InChI | InChI=1S/C17H30ClN2O2P/c1-14(2)11-12-19(5)23(21,20(6)13-15(3)4)22-17-9-7-16(18)8-10-17/h7-10,14-15H,11-13H2,1-6H3 |
| InChIKey | XYXWCHQHFLNDBV-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.87 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|