C8H17NO — CID 59360097
N-methoxy-N,4-dimethylpent-3-en-1-amine (PubChem CID 59360097) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is N-methoxy-N,4-dimethylpent-3-en-1-amine.
| Compound Name | N-methoxy-N,4-dimethylpent-3-en-1-amine |
|---|---|
| PubChem CID | 59360097 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | N-methoxy-N,4-dimethylpent-3-en-1-amine |
| SMILES | CON(C)CCC=C(C)C |
| InChI | InChI=1S/C8H17NO/c1-8(2)6-5-7-9(3)10-4/h6H,5,7H2,1-4H3 |
| InChIKey | MIZFTYKDYHNCEO-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|