C16H18NO5P — CID 164912358
4-(diphenoxyphosphorylamino)butanoic acid (PubChem CID 164912358) has the molecular formula C16H18NO5P and a molecular weight of 335.30 g/mol. Its IUPAC name is 4-(diphenoxyphosphorylamino)butanoic acid.
| Compound Name | 4-(diphenoxyphosphorylamino)butanoic acid |
|---|---|
| PubChem CID | 164912358 |
| Molecular Formula | C16H18NO5P |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 4-(diphenoxyphosphorylamino)butanoic acid |
| SMILES | O=C(O)CCCNP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C16H18NO5P/c18-16(19)12-7-13-17-23(20,21-14-8-3-1-4-9-14)22-15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2,(H,17,20)(H,18,19) |
| InChIKey | WYUHXEPZHNSEQR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|