About 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide
2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide (PubChem CID 24841656) has the molecular formula C15H19BrN3O3PS
and a molecular weight of 432.28 g/mol. Its IUPAC name is 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide.
Molecular Properties
| Compound Name | 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide |
| PubChem CID | 24841656 |
| Molecular Formula | C15H19BrN3O3PS |
| Molecular Weight | 432.28 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SCCNP(=O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C15H18N3O3PS.BrH/c16-15(17)23-12-11-18-22(19,20-13-7-3-1-4-8-13)21-14-9-5-2-6-10-14;/h1-10H,11-12H2,(H3,16,17)(H,18,19);1H |
| InChIKey | XDVFXAIHDTZNPG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 97.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide?
The IUPAC name of 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide (CID 24841656) is 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide.
What is the SMILES notation for 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide?
The canonical SMILES for 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide is Br.[H]/N=C(\N)SCCNP(=O)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide?
The InChIKey is XDVFXAIHDTZNPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N3O3PS.BrH/c16-15(17)23-12-11-18-22(19,20-13-7-3-1-4-8-13)21-14-9-5-2-6-10-14;/h1-10H,11-12H2,(H3,16,17)(H,18,19);1H.
What are the key properties of 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide?
2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide has a molecular weight of 432.28 g/mol, XLogP of 4.05, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diphenoxyphosphorylamino)ethyl carbamimidothioate;hydrobromide is sourced from PubChem (CID 24841656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).