About diphenylphosphorylmethyl carbamimidothioate;hydrochloride
diphenylphosphorylmethyl carbamimidothioate;hydrochloride (PubChem CID 16682079) has the molecular formula C14H16ClN2OPS
and a molecular weight of 326.79 g/mol. Its IUPAC name is diphenylphosphorylmethyl carbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | diphenylphosphorylmethyl carbamimidothioate;hydrochloride |
| PubChem CID | 16682079 |
| Molecular Formula | C14H16ClN2OPS |
| Molecular Weight | 326.79 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | diphenylphosphorylmethyl carbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)SCP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C14H15N2OPS.ClH/c15-14(16)19-11-18(17,12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h1-10H,11H2,(H3,15,16);1H |
| InChIKey | BTRNDXBAUDLQKH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.79 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphenylphosphorylmethyl carbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphenylphosphorylmethyl carbamimidothioate;hydrochloride?
The IUPAC name of diphenylphosphorylmethyl carbamimidothioate;hydrochloride (CID 16682079) is diphenylphosphorylmethyl carbamimidothioate;hydrochloride.
What is the SMILES notation for diphenylphosphorylmethyl carbamimidothioate;hydrochloride?
The canonical SMILES for diphenylphosphorylmethyl carbamimidothioate;hydrochloride is Cl.[H]/N=C(\N)SCP(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of diphenylphosphorylmethyl carbamimidothioate;hydrochloride?
The InChIKey is BTRNDXBAUDLQKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N2OPS.ClH/c15-14(16)19-11-18(17,12-7-3-1-4-8-12)13-9-5-2-6-10-13;/h1-10H,11H2,(H3,15,16);1H.
What are the key properties of diphenylphosphorylmethyl carbamimidothioate;hydrochloride?
diphenylphosphorylmethyl carbamimidothioate;hydrochloride has a molecular weight of 326.79 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diphenylphosphorylmethyl carbamimidothioate;hydrochloride is sourced from PubChem (CID 16682079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).