About diethylphosphorylmethyl carbamimidothioate;hydrochloride
diethylphosphorylmethyl carbamimidothioate;hydrochloride (PubChem CID 2840069) has the molecular formula C6H16ClN2OPS
and a molecular weight of 230.70 g/mol. Its IUPAC name is diethylphosphorylmethyl carbamimidothioate;hydrochloride.
Molecular Properties
| Compound Name | diethylphosphorylmethyl carbamimidothioate;hydrochloride |
| PubChem CID | 2840069 |
| Molecular Formula | C6H16ClN2OPS |
| Molecular Weight | 230.70 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | diethylphosphorylmethyl carbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)SCP(=O)(CC)CC |
| InChI | InChI=1S/C6H15N2OPS.ClH/c1-3-10(9,4-2)5-11-6(7)8;/h3-5H2,1-2H3,(H3,7,8);1H |
| InChIKey | ZKMMVGIOOMLFEV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.70 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethylphosphorylmethyl carbamimidothioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylphosphorylmethyl carbamimidothioate;hydrochloride?
The IUPAC name of diethylphosphorylmethyl carbamimidothioate;hydrochloride (CID 2840069) is diethylphosphorylmethyl carbamimidothioate;hydrochloride.
What is the SMILES notation for diethylphosphorylmethyl carbamimidothioate;hydrochloride?
The canonical SMILES for diethylphosphorylmethyl carbamimidothioate;hydrochloride is Cl.[H]/N=C(\N)SCP(=O)(CC)CC.
What is the InChIKey of diethylphosphorylmethyl carbamimidothioate;hydrochloride?
The InChIKey is ZKMMVGIOOMLFEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N2OPS.ClH/c1-3-10(9,4-2)5-11-6(7)8;/h3-5H2,1-2H3,(H3,7,8);1H.
What are the key properties of diethylphosphorylmethyl carbamimidothioate;hydrochloride?
diethylphosphorylmethyl carbamimidothioate;hydrochloride has a molecular weight of 230.70 g/mol, XLogP of 2.40, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diethylphosphorylmethyl carbamimidothioate;hydrochloride is sourced from PubChem (CID 2840069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).