About 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide
2-carbamimidoylsulfanylethyl carbamimidothioate dibromide (PubChem CID 21236844) has the molecular formula C4H10Br2N4S2-2
and a molecular weight of 338.09 g/mol. Its IUPAC name is 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide.
Molecular Properties
| Compound Name | 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide |
| PubChem CID | 21236844 |
| Molecular Formula | C4H10Br2N4S2-2 |
| Molecular Weight | 338.09 g/mol |
| Exact Mass | 335.87 |
| IUPAC Name | 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide |
| SMILES | [Br-].[Br-].[H]/N=C(\N)SCCS/C(N)=N/[H] |
| InChI | InChI=1S/C4H10N4S2.2BrH/c5-3(6)9-1-2-10-4(7)8;;/h1-2H2,(H3,5,6)(H3,7,8);2*1H/p-2 |
| InChIKey | VABTXEYLYWGJRB-UHFFFAOYSA-L |
| XLogP | -5.75 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.09 |
| LogP ≤ 5 | -5.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide?
The IUPAC name of 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide (CID 21236844) is 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide.
What is the SMILES notation for 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide?
The canonical SMILES for 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide is [Br-].[Br-].[H]/N=C(\N)SCCS/C(N)=N/[H].
What is the InChIKey of 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide?
The InChIKey is VABTXEYLYWGJRB-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H10N4S2.2BrH/c5-3(6)9-1-2-10-4(7)8;;/h1-2H2,(H3,5,6)(H3,7,8);2*1H/p-2.
What are the key properties of 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide?
2-carbamimidoylsulfanylethyl carbamimidothioate dibromide has a molecular weight of 338.09 g/mol, XLogP of -5.75, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carbamimidoylsulfanylethyl carbamimidothioate dibromide is sourced from PubChem (CID 21236844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).