C5H12N4O2S2 — CID 175930492
3-carbamimidoylsulfanylpropanoic acid;thiourea (PubChem CID 175930492) has the molecular formula C5H12N4O2S2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 3-carbamimidoylsulfanylpropanoic acid;thiourea.
| Compound Name | 3-carbamimidoylsulfanylpropanoic acid;thiourea |
|---|---|
| PubChem CID | 175930492 |
| Molecular Formula | C5H12N4O2S2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 3-carbamimidoylsulfanylpropanoic acid;thiourea |
| SMILES | NC(N)=S.[H]/N=C(\N)SCCC(=O)O |
| InChI | InChI=1S/C4H8N2O2S.CH4N2S/c5-4(6)9-2-1-3(7)8;2-1(3)4/h1-2H2,(H3,5,6)(H,7,8);(H4,2,3,4) |
| InChIKey | QDXXITROJANMHM-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|