About 2-methylsulfonylethyl carbamimidothioate
2-methylsulfonylethyl carbamimidothioate (PubChem CID 3799956) has the molecular formula C4H10N2O2S2
and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-methylsulfonylethyl carbamimidothioate.
Molecular Properties
| Compound Name | 2-methylsulfonylethyl carbamimidothioate |
| PubChem CID | 3799956 |
| Molecular Formula | C4H10N2O2S2 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 2-methylsulfonylethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCS(C)(=O)=O |
| InChI | InChI=1S/C4H10N2O2S2/c1-10(7,8)3-2-9-4(5)6/h2-3H2,1H3,(H3,5,6) |
| InChIKey | UKENHBNVFOZTEU-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 84.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfonylethyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfonylethyl carbamimidothioate?
The IUPAC name of 2-methylsulfonylethyl carbamimidothioate (CID 3799956) is 2-methylsulfonylethyl carbamimidothioate.
What is the SMILES notation for 2-methylsulfonylethyl carbamimidothioate?
The canonical SMILES for 2-methylsulfonylethyl carbamimidothioate is [H]/N=C(\N)SCCS(C)(=O)=O.
What is the InChIKey of 2-methylsulfonylethyl carbamimidothioate?
The InChIKey is UKENHBNVFOZTEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O2S2/c1-10(7,8)3-2-9-4(5)6/h2-3H2,1H3,(H3,5,6).
What are the key properties of 2-methylsulfonylethyl carbamimidothioate?
2-methylsulfonylethyl carbamimidothioate has a molecular weight of 182.27 g/mol, XLogP of -0.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfonylethyl carbamimidothioate is sourced from PubChem (CID 3799956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).