C15H24N4O2S3 — CID 170226116
2-[4-[(2S)-2-carbamimidoylsulfanyl-4-methylsulfonylbutyl]phenyl]ethyl carbamimidothioate (PubChem CID 170226116) has the molecular formula C15H24N4O2S3 and a molecular weight of 388.58 g/mol. Its IUPAC name is 2-[4-[(2S)-2-carbamimidoylsulfanyl-4-methylsulfonylbutyl]phenyl]ethyl carbamimidothioate.
| Compound Name | 2-[4-[(2S)-2-carbamimidoylsulfanyl-4-methylsulfonylbutyl]phenyl]ethyl carbamimidothioate |
|---|---|
| PubChem CID | 170226116 |
| Molecular Formula | C15H24N4O2S3 |
| Molecular Weight | 388.58 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 2-[4-[(2S)-2-carbamimidoylsulfanyl-4-methylsulfonylbutyl]phenyl]ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCc1ccc(C[C@@H](CCS(C)(=O)=O)S/C(N)=N/[H])cc1 |
| InChI | InChI=1S/C15H24N4O2S3/c1-24(20,21)9-7-13(23-15(18)19)10-12-4-2-11(3-5-12)6-8-22-14(16)17/h2-5,13H,6-10H2,1H3,(H3,16,17)(H3,18,19)/t13-/m1/s1 |
| InChIKey | FWJUJRSIIUIZKN-CYBMUJFWSA-N |
| XLogP | 1.83 |
| TPSA | 133.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.58 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|