C16H22N6OS2 — CID 170226107
2-[4-[(2R)-2-carbamimidoylsulfanyl-4-(1,3,4-oxadiazol-2-yl)butyl]phenyl]ethyl carbamimidothioate (PubChem CID 170226107) has the molecular formula C16H22N6OS2 and a molecular weight of 378.53 g/mol. Its IUPAC name is 2-[4-[(2R)-2-carbamimidoylsulfanyl-4-(1,3,4-oxadiazol-2-yl)butyl]phenyl]ethyl carbamimidothioate.
| Compound Name | 2-[4-[(2R)-2-carbamimidoylsulfanyl-4-(1,3,4-oxadiazol-2-yl)butyl]phenyl]ethyl carbamimidothioate |
|---|---|
| PubChem CID | 170226107 |
| Molecular Formula | C16H22N6OS2 |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-[4-[(2R)-2-carbamimidoylsulfanyl-4-(1,3,4-oxadiazol-2-yl)butyl]phenyl]ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCc1ccc(C[C@@H](CCc2nnco2)S/C(N)=N/[H])cc1 |
| InChI | InChI=1S/C16H22N6OS2/c17-15(18)24-8-7-11-1-3-12(4-2-11)9-13(25-16(19)20)5-6-14-22-21-10-23-14/h1-4,10,13H,5-9H2,(H3,17,18)(H3,19,20)/t13-/m1/s1 |
| InChIKey | IKRSLUVQWUYALF-CYBMUJFWSA-N |
| XLogP | 2.41 |
| TPSA | 138.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|