C15H18N4S2 — CID 169053067
2-[4-(2-pyrimidin-2-ylsulfanylethyl)phenyl]ethyl carbamimidothioate (PubChem CID 169053067) has the molecular formula C15H18N4S2 and a molecular weight of 318.47 g/mol. Its IUPAC name is 2-[4-(2-pyrimidin-2-ylsulfanylethyl)phenyl]ethyl carbamimidothioate.
| Compound Name | 2-[4-(2-pyrimidin-2-ylsulfanylethyl)phenyl]ethyl carbamimidothioate |
|---|---|
| PubChem CID | 169053067 |
| Molecular Formula | C15H18N4S2 |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-[4-(2-pyrimidin-2-ylsulfanylethyl)phenyl]ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCc1ccc(CCSc2ncccn2)cc1 |
| InChI | InChI=1S/C15H18N4S2/c16-14(17)20-10-6-12-2-4-13(5-3-12)7-11-21-15-18-8-1-9-19-15/h1-5,8-9H,6-7,10-11H2,(H3,16,17) |
| InChIKey | DOIALNPVRWHJSZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|