C16H27N5S2 — CID 170225972
2-[4-[(2S)-2-carbamimidoylsulfanyl-4-(dimethylamino)butyl]phenyl]ethyl carbamimidothioate (PubChem CID 170225972) has the molecular formula C16H27N5S2 and a molecular weight of 353.56 g/mol. Its IUPAC name is 2-[4-[(2S)-2-carbamimidoylsulfanyl-4-(dimethylamino)butyl]phenyl]ethyl carbamimidothioate.
| Compound Name | 2-[4-[(2S)-2-carbamimidoylsulfanyl-4-(dimethylamino)butyl]phenyl]ethyl carbamimidothioate |
|---|---|
| PubChem CID | 170225972 |
| Molecular Formula | C16H27N5S2 |
| Molecular Weight | 353.56 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 2-[4-[(2S)-2-carbamimidoylsulfanyl-4-(dimethylamino)butyl]phenyl]ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SCCc1ccc(C[C@@H](CCN(C)C)S/C(N)=N/[H])cc1 |
| InChI | InChI=1S/C16H27N5S2/c1-21(2)9-7-14(23-16(19)20)11-13-5-3-12(4-6-13)8-10-22-15(17)18/h3-6,14H,7-11H2,1-2H3,(H3,17,18)(H3,19,20)/t14-/m1/s1 |
| InChIKey | PGAZPQXRJSJMBF-CQSZACIVSA-N |
| XLogP | 2.35 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|