About 1-(dibenzylamino)ethyl carbamimidothioate
1-(dibenzylamino)ethyl carbamimidothioate (PubChem CID 21119148) has the molecular formula C17H21N3S
and a molecular weight of 299.44 g/mol. Its IUPAC name is 1-(dibenzylamino)ethyl carbamimidothioate.
Molecular Properties
| Compound Name | 1-(dibenzylamino)ethyl carbamimidothioate |
| PubChem CID | 21119148 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-(dibenzylamino)ethyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SC(C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C17H21N3S/c1-14(21-17(18)19)20(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3,(H3,18,19) |
| InChIKey | ZHSCQUVATVSFRF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(dibenzylamino)ethyl carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dibenzylamino)ethyl carbamimidothioate?
The IUPAC name of 1-(dibenzylamino)ethyl carbamimidothioate (CID 21119148) is 1-(dibenzylamino)ethyl carbamimidothioate.
What is the SMILES notation for 1-(dibenzylamino)ethyl carbamimidothioate?
The canonical SMILES for 1-(dibenzylamino)ethyl carbamimidothioate is [H]/N=C(\N)SC(C)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 1-(dibenzylamino)ethyl carbamimidothioate?
The InChIKey is ZHSCQUVATVSFRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3S/c1-14(21-17(18)19)20(12-15-8-4-2-5-9-15)13-16-10-6-3-7-11-16/h2-11,14H,12-13H2,1H3,(H3,18,19).
What are the key properties of 1-(dibenzylamino)ethyl carbamimidothioate?
1-(dibenzylamino)ethyl carbamimidothioate has a molecular weight of 299.44 g/mol, XLogP of 3.66, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dibenzylamino)ethyl carbamimidothioate is sourced from PubChem (CID 21119148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).