C15H17N3 — CID 9487
1,1-dibenzylguanidine (PubChem CID 9487) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 1,1-dibenzylguanidine.
| Compound Name | 1,1-dibenzylguanidine |
|---|---|
| PubChem CID | 9487 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 1,1-dibenzylguanidine |
| SMILES | [H]/N=C(\N)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H17N3/c16-15(17)18(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14/h1-10H,11-12H2,(H3,16,17) |
| InChIKey | MRXBEVRHPUOYNF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|