C18H21N3 — CID 146643292
N,N-dibenzyl-2-(methylamino)prop-2-enimidamide (PubChem CID 146643292) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is N,N-dibenzyl-2-(methylamino)prop-2-enimidamide.
| Compound Name | N,N-dibenzyl-2-(methylamino)prop-2-enimidamide |
|---|---|
| PubChem CID | 146643292 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N,N-dibenzyl-2-(methylamino)prop-2-enimidamide |
| SMILES | [H]/N=C(\C(=C)NC)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H21N3/c1-15(20-2)18(19)21(13-16-9-5-3-6-10-16)14-17-11-7-4-8-12-17/h3-12,19-20H,1,13-14H2,2H3/b19-18+ |
| InChIKey | HIOREONNGWTALH-VHEBQXMUSA-N |
| XLogP | 3.40 |
| TPSA | 39.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|