C18H20N2 — CID 63175386
N,N-dibenzylcyclopropanecarboximidamide (PubChem CID 63175386) has the molecular formula C18H20N2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N,N-dibenzylcyclopropanecarboximidamide.
| Compound Name | N,N-dibenzylcyclopropanecarboximidamide |
|---|---|
| PubChem CID | 63175386 |
| Molecular Formula | C18H20N2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.16 |
| IUPAC Name | N,N-dibenzylcyclopropanecarboximidamide |
| SMILES | [H]/N=C(\C1CC1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H20N2/c19-18(17-11-12-17)20(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16/h1-10,17,19H,11-14H2/b19-18+ |
| InChIKey | KVARXSFWYHLHDA-VHEBQXMUSA-N |
| XLogP | 4.08 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|