About 1-benzyl-1-ethyl-2,3-dimethylguanidine
1-benzyl-1-ethyl-2,3-dimethylguanidine (PubChem CID 130785557) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is 1-benzyl-1-ethyl-2,3-dimethylguanidine.
Molecular Properties
| Compound Name | 1-benzyl-1-ethyl-2,3-dimethylguanidine |
| PubChem CID | 130785557 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-benzyl-1-ethyl-2,3-dimethylguanidine |
| SMILES | CCN(Cc1ccccc1)/C(=N/C)NC |
| InChI | InChI=1S/C12H19N3/c1-4-15(12(13-2)14-3)10-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3,(H,13,14) |
| InChIKey | KRPGOLGAMWHTGJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-1-ethyl-2,3-dimethylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1-ethyl-2,3-dimethylguanidine?
The IUPAC name of 1-benzyl-1-ethyl-2,3-dimethylguanidine (CID 130785557) is 1-benzyl-1-ethyl-2,3-dimethylguanidine.
What is the SMILES notation for 1-benzyl-1-ethyl-2,3-dimethylguanidine?
The canonical SMILES for 1-benzyl-1-ethyl-2,3-dimethylguanidine is CCN(Cc1ccccc1)/C(=N/C)NC.
What is the InChIKey of 1-benzyl-1-ethyl-2,3-dimethylguanidine?
The InChIKey is KRPGOLGAMWHTGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-4-15(12(13-2)14-3)10-11-8-6-5-7-9-11/h5-9H,4,10H2,1-3H3,(H,13,14).
What are the key properties of 1-benzyl-1-ethyl-2,3-dimethylguanidine?
1-benzyl-1-ethyl-2,3-dimethylguanidine has a molecular weight of 205.31 g/mol, XLogP of 1.71, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1-ethyl-2,3-dimethylguanidine is sourced from PubChem (CID 130785557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).