C11H14N4 — CID 138679330
1-benzyl-1-cyano-2,3-dimethylguanidine (PubChem CID 138679330) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is 1-benzyl-1-cyano-2,3-dimethylguanidine.
| Compound Name | 1-benzyl-1-cyano-2,3-dimethylguanidine |
|---|---|
| PubChem CID | 138679330 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | 1-benzyl-1-cyano-2,3-dimethylguanidine |
| SMILES | C/N=C(\NC)N(C#N)Cc1ccccc1 |
| InChI | InChI=1S/C11H14N4/c1-13-11(14-2)15(9-12)8-10-6-4-3-5-7-10/h3-7H,8H2,1-2H3,(H,13,14) |
| InChIKey | PWSCNJYNOICIAS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 51.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|