C13H18N4O2S2 — CID 170225899
(2S)-2-carbamimidoylsulfanyl-3-[4-(2-carbamimidoylsulfanylethyl)phenyl]propanoic acid (PubChem CID 170225899) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is (2S)-2-carbamimidoylsulfanyl-3-[4-(2-carbamimidoylsulfanylethyl)phenyl]propanoic acid.
| Compound Name | (2S)-2-carbamimidoylsulfanyl-3-[4-(2-carbamimidoylsulfanylethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 170225899 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (2S)-2-carbamimidoylsulfanyl-3-[4-(2-carbamimidoylsulfanylethyl)phenyl]propanoic acid |
| SMILES | [H]/N=C(\N)SCCc1ccc(C[C@H](S/C(N)=N/[H])C(=O)O)cc1 |
| InChI | InChI=1S/C13H18N4O2S2/c14-12(15)20-6-5-8-1-3-9(4-2-8)7-10(11(18)19)21-13(16)17/h1-4,10H,5-7H2,(H3,14,15)(H3,16,17)(H,18,19)/t10-/m0/s1 |
| InChIKey | STERGLLSIFAZDH-JTQLQIEISA-N |
| XLogP | 1.48 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|