C6H11F3N4O2S2 — CID 54607664
2-carbamimidoylsulfanylethyl carbamimidothioate;2,2,2-trifluoroacetic acid (PubChem CID 54607664) has the molecular formula C6H11F3N4O2S2 and a molecular weight of 292.31 g/mol. Its IUPAC name is 2-carbamimidoylsulfanylethyl carbamimidothioate;2,2,2-trifluoroacetic acid.
| Compound Name | 2-carbamimidoylsulfanylethyl carbamimidothioate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 54607664 |
| Molecular Formula | C6H11F3N4O2S2 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-carbamimidoylsulfanylethyl carbamimidothioate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)SCCS/C(N)=N/[H] |
| InChI | InChI=1S/C4H10N4S2.C2HF3O2/c5-3(6)9-1-2-10-4(7)8;3-2(4,5)1(6)7/h1-2H2,(H3,5,6)(H3,7,8);(H,6,7) |
| InChIKey | UINXGVZOBLUSII-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 137.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|