C5H8F3N3OS — CID 60641794
[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] carbamimidothioate (PubChem CID 60641794) has the molecular formula C5H8F3N3OS and a molecular weight of 215.20 g/mol. Its IUPAC name is [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] carbamimidothioate.
| Compound Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] carbamimidothioate |
|---|---|
| PubChem CID | 60641794 |
| Molecular Formula | C5H8F3N3OS |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | [2-oxo-2-(2,2,2-trifluoroethylamino)ethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C5H8F3N3OS/c6-5(7,8)2-11-3(12)1-13-4(9)10/h1-2H2,(H3,9,10)(H,11,12) |
| InChIKey | JAWZWPWGOKXDHW-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|