C5H8BrF3N2S — CID 117062342
3,4,4-trifluorobut-3-enyl carbamimidothioate;hydrobromide (PubChem CID 117062342) has the molecular formula C5H8BrF3N2S and a molecular weight of 265.10 g/mol. Its IUPAC name is 3,4,4-trifluorobut-3-enyl carbamimidothioate;hydrobromide.
| Compound Name | 3,4,4-trifluorobut-3-enyl carbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 117062342 |
| Molecular Formula | C5H8BrF3N2S |
| Molecular Weight | 265.10 g/mol |
| Exact Mass | 263.95 |
| IUPAC Name | 3,4,4-trifluorobut-3-enyl carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)SCCC(F)=C(F)F |
| InChI | InChI=1S/C5H7F3N2S.BrH/c6-3(4(7)8)1-2-11-5(9)10;/h1-2H2,(H3,9,10);1H |
| InChIKey | AUUWQFOBZGGGNA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.10 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|