C7H11F3N2S — CID 134093243
3,4,4-trifluorobut-3-enyl N,N-dimethylcarbamimidothioate (PubChem CID 134093243) has the molecular formula C7H11F3N2S and a molecular weight of 212.24 g/mol. Its IUPAC name is 3,4,4-trifluorobut-3-enyl N,N-dimethylcarbamimidothioate.
| Compound Name | 3,4,4-trifluorobut-3-enyl N,N-dimethylcarbamimidothioate |
|---|---|
| PubChem CID | 134093243 |
| Molecular Formula | C7H11F3N2S |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 3,4,4-trifluorobut-3-enyl N,N-dimethylcarbamimidothioate |
| SMILES | [H]/N=C(\SCCC(F)=C(F)F)N(C)C |
| InChI | InChI=1S/C7H11F3N2S/c1-12(2)7(11)13-4-3-5(8)6(9)10/h11H,3-4H2,1-2H3/b11-7- |
| InChIKey | SGCHJWFXFOLNOW-XFFZJAGNSA-N |
| XLogP | 2.68 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|