C9H8F6S3 — CID 175727421
bis(3,4,4-trifluorobut-3-enylsulfanyl)methanethione (PubChem CID 175727421) has the molecular formula C9H8F6S3 and a molecular weight of 326.35 g/mol. Its IUPAC name is bis(3,4,4-trifluorobut-3-enylsulfanyl)methanethione.
| Compound Name | bis(3,4,4-trifluorobut-3-enylsulfanyl)methanethione |
|---|---|
| PubChem CID | 175727421 |
| Molecular Formula | C9H8F6S3 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 325.97 |
| IUPAC Name | bis(3,4,4-trifluorobut-3-enylsulfanyl)methanethione |
| SMILES | FC(F)=C(F)CCSC(=S)SCCC(F)=C(F)F |
| InChI | InChI=1S/C9H8F6S3/c10-5(7(12)13)1-3-17-9(16)18-4-2-6(11)8(14)15/h1-4H2 |
| InChIKey | XLYCNXIVPOUFEP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|