C11H15F7S2 — CID 15938579
2,3,3,4,4,5,5-heptafluoro-1,1-bis(propylsulfanyl)pent-1-ene (PubChem CID 15938579) has the molecular formula C11H15F7S2 and a molecular weight of 344.36 g/mol. Its IUPAC name is 2,3,3,4,4,5,5-heptafluoro-1,1-bis(propylsulfanyl)pent-1-ene.
| Compound Name | 2,3,3,4,4,5,5-heptafluoro-1,1-bis(propylsulfanyl)pent-1-ene |
|---|---|
| PubChem CID | 15938579 |
| Molecular Formula | C11H15F7S2 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 2,3,3,4,4,5,5-heptafluoro-1,1-bis(propylsulfanyl)pent-1-ene |
| SMILES | CCCSC(SCCC)=C(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H15F7S2/c1-3-5-19-8(20-6-4-2)7(12)10(15,16)11(17,18)9(13)14/h9H,3-6H2,1-2H3 |
| InChIKey | CCUBJSFPJBJGNA-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|