C8H7F9 — CID 87084484
1,1,2,3,3,4,4,5,5-nonafluorooct-1-ene (PubChem CID 87084484) has the molecular formula C8H7F9 and a molecular weight of 274.13 g/mol. Its IUPAC name is 1,1,2,3,3,4,4,5,5-nonafluorooct-1-ene.
| Compound Name | 1,1,2,3,3,4,4,5,5-nonafluorooct-1-ene |
|---|---|
| PubChem CID | 87084484 |
| Molecular Formula | C8H7F9 |
| Molecular Weight | 274.13 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | 1,1,2,3,3,4,4,5,5-nonafluorooct-1-ene |
| SMILES | CCCC(F)(F)C(F)(F)C(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C8H7F9/c1-2-3-6(12,13)8(16,17)7(14,15)4(9)5(10)11/h2-3H2,1H3 |
| InChIKey | TWAMBPQDLDRMSB-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.13 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|