C5Cl2F8 — CID 139602827
5,5-dichloro-1,1,2,3,3,4,4,5-octafluoropent-1-ene (PubChem CID 139602827) has the molecular formula C5Cl2F8 and a molecular weight of 282.95 g/mol. Its IUPAC name is 5,5-dichloro-1,1,2,3,3,4,4,5-octafluoropent-1-ene.
| Compound Name | 5,5-dichloro-1,1,2,3,3,4,4,5-octafluoropent-1-ene |
|---|---|
| PubChem CID | 139602827 |
| Molecular Formula | C5Cl2F8 |
| Molecular Weight | 282.95 g/mol |
| Exact Mass | 281.92 |
| IUPAC Name | 5,5-dichloro-1,1,2,3,3,4,4,5-octafluoropent-1-ene |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(F)C(F)(Cl)Cl |
| InChI | InChI=1S/C5Cl2F8/c6-5(7,15)4(13,14)3(11,12)1(8)2(9)10 |
| InChIKey | KGRARCNBJFQNDY-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.95 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|