C9Cl4F14 — CID 162539017
4,6,8,9-tetrachloro-1,1,2,3,3,4,5,5,6,7,7,8,9,9-tetradecafluoronon-1-ene (PubChem CID 162539017) has the molecular formula C9Cl4F14 and a molecular weight of 515.88 g/mol. Its IUPAC name is 4,6,8,9-tetrachloro-1,1,2,3,3,4,5,5,6,7,7,8,9,9-tetradecafluoronon-1-ene.
| Compound Name | 4,6,8,9-tetrachloro-1,1,2,3,3,4,5,5,6,7,7,8,9,9-tetradecafluoronon-1-ene |
|---|---|
| PubChem CID | 162539017 |
| Molecular Formula | C9Cl4F14 |
| Molecular Weight | 515.88 g/mol |
| Exact Mass | 513.85 |
| IUPAC Name | 4,6,8,9-tetrachloro-1,1,2,3,3,4,5,5,6,7,7,8,9,9-tetradecafluoronon-1-ene |
| SMILES | FC(F)=C(F)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C9Cl4F14/c10-4(19,3(17,18)1(14)2(15)16)7(22,23)5(11,20)8(24,25)6(12,21)9(13,26)27 |
| InChIKey | UOKARGYGYAOBMJ-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.88 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|