C10H5Cl4F11O — CID 154223636
5,7,9,10-tetrachloro-4,4,5,6,6,7,8,8,9,10,10-undecafluorodecan-3-one (PubChem CID 154223636) has the molecular formula C10H5Cl4F11O and a molecular weight of 491.94 g/mol. Its IUPAC name is 5,7,9,10-tetrachloro-4,4,5,6,6,7,8,8,9,10,10-undecafluorodecan-3-one.
| Compound Name | 5,7,9,10-tetrachloro-4,4,5,6,6,7,8,8,9,10,10-undecafluorodecan-3-one |
|---|---|
| PubChem CID | 154223636 |
| Molecular Formula | C10H5Cl4F11O |
| Molecular Weight | 491.94 g/mol |
| Exact Mass | 489.89 |
| IUPAC Name | 5,7,9,10-tetrachloro-4,4,5,6,6,7,8,8,9,10,10-undecafluorodecan-3-one |
| SMILES | CCC(=O)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)C(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C10H5Cl4F11O/c1-2-3(26)4(15,16)5(11,17)8(20,21)6(12,18)9(22,23)7(13,19)10(14,24)25/h2H2,1H3 |
| InChIKey | ATSNGDQBWSZYLA-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.94 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|