C4Cl4F6 — CID 98047490
(2S,3S)-1,2,3,4-tetrachloro-1,1,2,3,4,4-hexafluorobutane (PubChem CID 98047490) has the molecular formula C4Cl4F6 and a molecular weight of 303.84 g/mol. Its IUPAC name is (2S,3S)-1,2,3,4-tetrachloro-1,1,2,3,4,4-hexafluorobutane.
| Compound Name | (2S,3S)-1,2,3,4-tetrachloro-1,1,2,3,4,4-hexafluorobutane |
|---|---|
| PubChem CID | 98047490 |
| Molecular Formula | C4Cl4F6 |
| Molecular Weight | 303.84 g/mol |
| Exact Mass | 301.87 |
| IUPAC Name | (2S,3S)-1,2,3,4-tetrachloro-1,1,2,3,4,4-hexafluorobutane |
| SMILES | FC(F)(Cl)[C@@](F)(Cl)[C@](F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C4Cl4F6/c5-1(9,3(7,11)12)2(6,10)4(8,13)14/t1-,2-/m1/s1 |
| InChIKey | IRHYACQPDDXBCB-JCYAYHJZSA-N |
| XLogP | 4.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.84 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|