C4H2Cl2F5NaO — CID 134894294
sodium 3,4-dichloro-2,2,3,4,4-pentafluorobutan-1-olate (PubChem CID 134894294) has the molecular formula C4H2Cl2F5NaO and a molecular weight of 254.94 g/mol. Its IUPAC name is sodium 3,4-dichloro-2,2,3,4,4-pentafluorobutan-1-olate.
| Compound Name | sodium 3,4-dichloro-2,2,3,4,4-pentafluorobutan-1-olate |
|---|---|
| PubChem CID | 134894294 |
| Molecular Formula | C4H2Cl2F5NaO |
| Molecular Weight | 254.94 g/mol |
| Exact Mass | 253.93 |
| IUPAC Name | sodium 3,4-dichloro-2,2,3,4,4-pentafluorobutan-1-olate |
| SMILES | [Na+].[O-]CC(F)(F)C(F)(Cl)C(F)(F)Cl |
| InChI | InChI=1S/C4H2Cl2F5O.Na/c5-3(9,4(6,10)11)2(7,8)1-12;/h1H2;/q-1;+1 |
| InChIKey | USROOPMGRUEZCX-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.94 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|