C5H3ClF8O — CID 75406208
5-chloro-2,2,3,3,4,4,5,5-octafluoropentan-1-ol (PubChem CID 75406208) has the molecular formula C5H3ClF8O and a molecular weight of 266.51 g/mol. Its IUPAC name is 5-chloro-2,2,3,3,4,4,5,5-octafluoropentan-1-ol.
| Compound Name | 5-chloro-2,2,3,3,4,4,5,5-octafluoropentan-1-ol |
|---|---|
| PubChem CID | 75406208 |
| Molecular Formula | C5H3ClF8O |
| Molecular Weight | 266.51 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | 5-chloro-2,2,3,3,4,4,5,5-octafluoropentan-1-ol |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
| InChI | InChI=1S/C5H3ClF8O/c6-5(13,14)4(11,12)3(9,10)2(7,8)1-15/h15H,1H2 |
| InChIKey | KGWZMKSODUPSGD-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|