C9H5F15O2 — CID 12933465
2,2,3,3,4,4,5,5,7,8,8,8-dodecafluoro-7-(trifluoromethyl)octane-1,6-diol (PubChem CID 12933465) has the molecular formula C9H5F15O2 and a molecular weight of 430.11 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,7,8,8,8-dodecafluoro-7-(trifluoromethyl)octane-1,6-diol.
| Compound Name | 2,2,3,3,4,4,5,5,7,8,8,8-dodecafluoro-7-(trifluoromethyl)octane-1,6-diol |
|---|---|
| PubChem CID | 12933465 |
| Molecular Formula | C9H5F15O2 |
| Molecular Weight | 430.11 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | 2,2,3,3,4,4,5,5,7,8,8,8-dodecafluoro-7-(trifluoromethyl)octane-1,6-diol |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(O)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H5F15O2/c10-3(11,1-25)6(15,16)7(17,18)5(13,14)2(26)4(12,8(19,20)21)9(22,23)24/h2,25-26H,1H2 |
| InChIKey | KEPFWWQDAPGJKE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.11 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|